CAS 391251-83-5 is the registry number for (2-Amino-4,5-dimethoxyphenyl)(p-tolyl)methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g.
(2-amino-4,5-dimethoxyphenyl)-(4-methylphenyl)methanone (CAS 391251-83-5) is a chemical compound with the molecular formula C16H17NO3 and a molecular weight of 271.31 g/mol. IUPAC name: (2-amino-4,5-dimethoxyphenyl)-(4-methylphenyl)methanone. InChIKey: RZPGVXAXYJOPTJ-UHFFFAOYSA-N.
| Molecular formula | C16H17NO3 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | (2-amino-4,5-dimethoxyphenyl)-(4-methylphenyl)methanone |
| InChIKey | RZPGVXAXYJOPTJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2N)OC)OC |
Computed by PubChem (NCBI)