Products 1826110-24-0

CAS 1826110-24-0 is the registry number for Benzyl 2-isopropoxynicotinate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Benzyl 2-propan-2-yloxypyridine-3-carboxylate (CAS 1826110-24-0) is a chemical compound with the molecular formula C16H17NO3 and a molecular weight of 271.31 g/mol. IUPAC name: benzyl 2-propan-2-yloxypyridine-3-carboxylate. InChIKey: FEQBUBOOIFBVJM-UHFFFAOYSA-N.

Identity
Molecular formulaC16H17NO3
Molecular weight271.31 g/mol
IUPAC namebenzyl 2-propan-2-yloxypyridine-3-carboxylate
InChIKeyFEQBUBOOIFBVJM-UHFFFAOYSA-N
SMILESCC(C)OC1=C(C=CC=N1)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)