CAS 52034-37-4 is the registry number for Ethyl 4-(3-formyl-2,5-dimethyl-1h-pyrrol-1-yl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Ethyl 4-(3-formyl-2,5-dimethylpyrrol-1-yl)benzoate (CAS 52034-37-4) is a chemical compound with the molecular formula C16H17NO3 and a molecular weight of 271.31 g/mol. IUPAC name: ethyl 4-(3-formyl-2,5-dimethylpyrrol-1-yl)benzoate. InChIKey: INHIPLWUOJQIIQ-UHFFFAOYSA-N.
| Molecular formula | C16H17NO3 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | ethyl 4-(3-formyl-2,5-dimethylpyrrol-1-yl)benzoate |
| InChIKey | INHIPLWUOJQIIQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)N2C(=CC(=C2C)C=O)C |
Computed by PubChem (NCBI)