CAS 908066-52-4 is the registry number for (S)-Methyl 2-amino-2-(4-(benzyloxy)phenyl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl (2S)-2-amino-2-(4-phenylmethoxyphenyl)acetate (CAS 908066-52-4) is a chemical compound with the molecular formula C16H17NO3 and a molecular weight of 271.31 g/mol. IUPAC name: methyl (2S)-2-amino-2-(4-phenylmethoxyphenyl)acetate. InChIKey: ZTGSRCQPKWGKQB-HNNXBMFYSA-N.
| Molecular formula | C16H17NO3 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-(4-phenylmethoxyphenyl)acetate |
| InChIKey | ZTGSRCQPKWGKQB-HNNXBMFYSA-N |
| SMILES | COC(=O)[C@H](C1=CC=C(C=C1)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)