CAS 1172712-44-5 is the registry number for 4-Formyl-2,5-dimethyl-1-(3-methylbenzyl)-1h-pyrrole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-formyl-2,5-dimethyl-1-[(3-methylphenyl)methyl]pyrrole-3-carboxylic acid (CAS 1172712-44-5) is a chemical compound with the molecular formula C16H17NO3 and a molecular weight of 271.31 g/mol. IUPAC name: 4-formyl-2,5-dimethyl-1-[(3-methylphenyl)methyl]pyrrole-3-carboxylic acid. InChIKey: YPWUNZVUIBWSDF-UHFFFAOYSA-N.
| Molecular formula | C16H17NO3 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 4-formyl-2,5-dimethyl-1-[(3-methylphenyl)methyl]pyrrole-3-carboxylic acid |
| InChIKey | YPWUNZVUIBWSDF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CN2C(=C(C(=C2C)C(=O)O)C=O)C |
Computed by PubChem (NCBI)