CAS 130406-31-4 appears in our catalog under these names: Cbz-(s)-2-phenylglycinol, 95%, Cbz-(S)-2-phenylglycinol, 98%, 98%, (S)-Benzyl (2-hydroxy-1-phenylethyl)carbamate, 98%, Cbz-Phg-ol, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 1g, 5g, 100mg, 250mg, 10g.
Benzyl N-[(1S)-2-hydroxy-1-phenylethyl]carbamate (CAS 130406-31-4) is a chemical compound with the molecular formula C16H17NO3 and a molecular weight of 271.31 g/mol. IUPAC name: benzyl N-[(1S)-2-hydroxy-1-phenylethyl]carbamate. InChIKey: IWSCPMJLIZGTHY-OAHLLOKOSA-N.
| Molecular formula | C16H17NO3 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | benzyl N-[(1S)-2-hydroxy-1-phenylethyl]carbamate |
| InChIKey | IWSCPMJLIZGTHY-OAHLLOKOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CO)C2=CC=CC=C2 |
Computed by PubChem (NCBI)