cas: 1239592-10-9 — see every product listed under this CAS number, including other names
Ethyl 5-chloro-2,4-difluorobenzoate, 95+% (CAS 1239592-10-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A129028-25g |
| cas | 1239592-10-9 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 33329.59 Pln | |
| AmBeed | 10g | 16996.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl 5-chloro-2,4-difluorobenzoate (CAS 1239592-10-9) is a chemical compound with the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. IUPAC name: ethyl 5-chloro-2,4-difluorobenzoate. InChIKey: KLOWKADDOFKRKP-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O2 |
|---|---|
| Molecular weight | 220.60 g/mol |
| IUPAC name | ethyl 5-chloro-2,4-difluorobenzoate |
| InChIKey | KLOWKADDOFKRKP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1F)F)Cl |
Computed by PubChem (NCBI)