Ethyl 5-chloro-2-hydroxy-3-nitrobenzoate, 95+%
cas: 159323-96-3 — see every product listed under this CAS number, including other names
Ethyl 5-chloro-2-hydroxy-3-nitrobenzoate, 95+% (CAS 159323-96-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Fluorochem, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1490744-100mg |
| cas | 159323-96-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 398.19 Pln | |
| Ambeed | 1g | 948.88 Pln | |
| Fluorochem | 1g | 2049.30 Pln | |
| BLDpharm | 100mg | 281.04 Pln | |
| BLDpharm | 250mg | 425.43 Pln | |
| BLDpharm | 1g | 1019.67 Pln | |
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 448.40 Pln | |
| Chemat | 1g | 1106.00 Pln | |
| Fluorochem | 100mg | 518.59 Pln | |
| Fluorochem | 250mg | 810.15 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
Ethyl 5-chloro-2-hydroxy-3-nitrobenzoate (CAS 159323-96-3) is a chemical compound with the molecular formula C9H8ClNO5 and a molecular weight of 245.61 g/mol. IUPAC name: ethyl 5-chloro-2-hydroxy-3-nitrobenzoate. InChIKey: UPPGKFOEZDUZBC-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO5 |
|---|---|
| Molecular weight | 245.61 g/mol |
| IUPAC name | ethyl 5-chloro-2-hydroxy-3-nitrobenzoate |
| InChIKey | UPPGKFOEZDUZBC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC(=C1)Cl)[N+](=O)[O-])O |
Computed by PubChem (NCBI)