Products 159323-96-3
CAS 159323-96-3 is the registry number for Ethyl 5-chloro-2-hydroxy-3-nitrobenzoate, 95+%. Offered by: Ambeed, Fluorochem, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 5-chloro-2-hydroxy-3-nitrobenzoate (CAS 159323-96-3) is a chemical compound with the molecular formula C9H8ClNO5 and a molecular weight of 245.61 g/mol. IUPAC name: ethyl 5-chloro-2-hydroxy-3-nitrobenzoate. InChIKey: UPPGKFOEZDUZBC-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO5 |
|---|---|
| Molecular weight | 245.61 g/mol |
| IUPAC name | ethyl 5-chloro-2-hydroxy-3-nitrobenzoate |
| InChIKey | UPPGKFOEZDUZBC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC(=C1)Cl)[N+](=O)[O-])O |
Computed by PubChem (NCBI)