Products 20323-74-4
CAS 20323-74-4 appears in our catalog under these names: Ethyl 6-aminoveratrate, Ethyl 2-amino-4,5-dimethoxybenzoate, 98%, 98%, Ethyl 6-amino-3,4-dimethoxybenzoate, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 10g, 250mg, 1g, 5g.
Ethyl 2-amino-4,5-dimethoxybenzoate (CAS 20323-74-4) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: ethyl 2-amino-4,5-dimethoxybenzoate. InChIKey: SMICMEHDDWELMR-UHFFFAOYSA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | ethyl 2-amino-4,5-dimethoxybenzoate |
| InChIKey | SMICMEHDDWELMR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1N)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
Ethyl 2-amino-4,5-dimethoxybenzoate, Ethyl 6-amino-3,4-dimethoxybenzoate, Benzoic acid, 2-amino-4,5-dimethoxy-, ethyl ester, 6-Amino-3,4-dimethoxybenzoic acid ethyl ester, 2-amino-4,5-dimethoxybenzoic acid ethyl ester, Ethyl 4,5-dimethoxyanthranilate, Ethyl 6-aminoveratrate, ethyl 2-amino-4,5-dimethoxy-benzoate, Ethyl 2-amino-4,5-dimethoxybenzoate #