cas: 64119-42-2 — see every product listed under this CAS number, including other names
Ethyl 6-chloro-5-cyano-2-methylpyridine-3-carboxylate 95% (CAS 64119-42-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A149107-100mg |
| cas | 64119-42-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 909.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A149107 |
Ethyl 6-chloro-5-cyano-2-methylpyridine-3-carboxylate (CAS 64119-42-2) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: ethyl 6-chloro-5-cyano-2-methylpyridine-3-carboxylate. InChIKey: QXZBVLFURRXJLB-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | ethyl 6-chloro-5-cyano-2-methylpyridine-3-carboxylate |
| InChIKey | QXZBVLFURRXJLB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(C(=C1)C#N)Cl)C |
Computed by PubChem (NCBI)