Ethyl quinoline-2-carboxylate 98%
cas: 4491-33-2 — see every product listed under this CAS number, including other names
Ethyl quinoline-2-carboxylate 98% (CAS 4491-33-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A202390-250mg |
| cas | 4491-33-2 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 565.06 Pln | |
| Ambeed | 10g | 909.94 Pln | |
| Ambeed | 25g | 1744.31 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A202390 |
Ethyl quinoline-2-carboxylate (CAS 4491-33-2) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: ethyl quinoline-2-carboxylate. InChIKey: PWOYTBYNBYNZCO-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | ethyl quinoline-2-carboxylate |
| InChIKey | PWOYTBYNBYNZCO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=CC=CC=C2C=C1 |
Computed by PubChem (NCBI)