Products 2109805-87-8
CAS 2109805-87-8 appears in our catalog under these names: FEN1–IN–3, FEN1-IN-3/ 98.16% (existing batch purity), FEN1-IN-3, FEN1-IN-3 98%, 3-Hydroxy-1-(4-methoxyphenyl)quinazoline-2,4(1H,3H)-dione, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 5mg, 50mg, 1mg, 25mg, 500mg.
3-hydroxy-1-(4-methoxyphenyl)quinazoline-2,4-dione (CAS 2109805-87-8) is a chemical compound with the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. IUPAC name: 3-hydroxy-1-(4-methoxyphenyl)quinazoline-2,4-dione. InChIKey: BBJIIPZSHQTBLW-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O4 |
|---|---|
| Molecular weight | 284.27 g/mol |
| IUPAC name | 3-hydroxy-1-(4-methoxyphenyl)quinazoline-2,4-dione |
| InChIKey | BBJIIPZSHQTBLW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C3=CC=CC=C3C(=O)N(C2=O)O |
Computed by PubChem (NCBI)