FMOC-AMCP-OH, 95%, 95%
cas: 1263045-62-0 — see every product listed under this CAS number, including other names
FMOC-AMCP-OH, 95%, 95% (CAS 1263045-62-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110C3O-100mg |
| cas | 1263045-62-0 |
| size | 100mg |
| availability | 75g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 472.40 Pln | |
| Chemat | 1g | 899.60 Pln | |
| Chemat | 5g | 1941.20 Pln | |
| Chemat | 25g | 6453.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]cyclopropane-1-carboxylic acid (CAS 1263045-62-0) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: 1-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]cyclopropane-1-carboxylic acid. InChIKey: FLEXEGCTGAJEAR-UHFFFAOYSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 1-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]cyclopropane-1-carboxylic acid |
| InChIKey | FLEXEGCTGAJEAR-UHFFFAOYSA-N |
| SMILES | C1CC1(CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-Amcp-OH, 1-[(Fmoc-amino)methyl]cyclopropanecarboxylic acid, Fmoc-ACPA, 1-(Fmoc-aminomethyl)cyclopropyl-1-carboxylic acid, 1-(((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)methyl)cyclopropanecarboxylic acid, 1-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]cyclopropane-1-carboxylic acid, Fmoc-ACPA-OH, 1-(9-Fluorenylmethyloxycarbonyl-aminomethyl)-cyclopropyl-1-carboxylic acid, 1-(9-Fluorenylmethyloxycarbonylamino-methyl)-cyclopropyl-1-carboxylic acid, 1-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]cyclopropanecarboxylic acid