cas: 1263045-62-0 — see every product listed under this CAS number, including other names
Fmoc-AMCP-OH (CAS 1263045-62-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg, 500mg. Offered by: Iris Biotech.
| brand | Iris Biotech |
|---|---|
| catalog number | FAA0014.0001 |
| cas | 1263045-62-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Iris Biotech | 1g | 812.24 Pln | |
| Iris Biotech | 5g | 2618.00 Pln | |
| Iris Biotech | 250mg | 360.80 Pln | |
| Iris Biotech | 500mg | 561.44 Pln |
| purity | No data |
|---|---|
| delivery time | 2 weeks |
1-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]cyclopropane-1-carboxylic acid (CAS 1263045-62-0) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: 1-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]cyclopropane-1-carboxylic acid. InChIKey: FLEXEGCTGAJEAR-UHFFFAOYSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 1-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]cyclopropane-1-carboxylic acid |
| InChIKey | FLEXEGCTGAJEAR-UHFFFAOYSA-N |
| SMILES | C1CC1(CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)