cas: 127043-32-7 — see every product listed under this CAS number, including other names
FMOC-D-ALA-ALDEHYDE, 97%, 97% (CAS 127043-32-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110C3F-100mg |
| cas | 127043-32-7 |
| size | 100mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 664.40 Pln | |
| Chemat | 250mg | 1163.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
9H-fluoren-9-ylmethyl N-[(2R)-1-oxopropan-2-yl]carbamate (CAS 127043-32-7) is a chemical compound with the molecular formula C18H17NO3 and a molecular weight of 295.3 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(2R)-1-oxopropan-2-yl]carbamate. InChIKey: LJGFXAKKZLFEDR-GFCCVEGCSA-N.
| Molecular formula | C18H17NO3 |
|---|---|
| Molecular weight | 295.3 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(2R)-1-oxopropan-2-yl]carbamate |
| InChIKey | LJGFXAKKZLFEDR-GFCCVEGCSA-N |
| SMILES | C[C@H](C=O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)