Products 2585198-87-2
CAS 2585198-87-2 appears in our catalog under these names: FTO-IN-3/ 98.61% (existing batch purity), FTO-IN-3 99%, FTO-IN-3, FTO-IN-3, 99.79%. Offered by: TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
6-(2-methoxypyrimidin-5-yl)-1,3-benzothiazol-2-amine (CAS 2585198-87-2) is a chemical compound with the molecular formula C12H10N4OS and a molecular weight of 258.30 g/mol. IUPAC name: 6-(2-methoxypyrimidin-5-yl)-1,3-benzothiazol-2-amine. InChIKey: POOYWDOOHWPQCU-UHFFFAOYSA-N.
| Molecular formula | C12H10N4OS |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 6-(2-methoxypyrimidin-5-yl)-1,3-benzothiazol-2-amine |
| InChIKey | POOYWDOOHWPQCU-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C=N1)C2=CC3=C(C=C2)N=C(S3)N |
Computed by PubChem (NCBI)