CAS 61012-31-5 appears in our catalog under these names: Ferulamide, Ferulamide/ 99.45% (existing batch purity), Ferulamide, 99.10%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 1 mg.
(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide (CAS 61012-31-5) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide. InChIKey: YYAJJKZSQWOLIP-HWKANZROSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
| InChIKey | YYAJJKZSQWOLIP-HWKANZROSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)N)O |
Computed by PubChem (NCBI)