Products 6284-80-6
CAS 6284-80-6 appears in our catalog under these names: Fluorene-9-acetic acid, 99+% , 9-Fluoreneacetic Acid, >98.0%(T), 2-(9H-Fluoren-9-yl)acetic acid 98%, 2-(9H-Fluoren-9-yl)acetic acid, 98%, 98%, (9H-Fluoren-9-yl)acetic acid, 98%. Offered by: Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100mg.
2-(9H-fluoren-9-yl)acetic acid (CAS 6284-80-6) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: 2-(9H-fluoren-9-yl)acetic acid. InChIKey: WFSMJMTYIMFHPV-UHFFFAOYSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | 2-(9H-fluoren-9-yl)acetic acid |
| InChIKey | WFSMJMTYIMFHPV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)CC(=O)O |
Computed by PubChem (NCBI)