CAS 7329-77-3 is the registry number for 4-(2-Phenylethenyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-[(E)-2-phenylethenyl]benzoic acid (CAS 7329-77-3) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: 4-[(E)-2-phenylethenyl]benzoic acid. InChIKey: IAGXTPCOGVFRSQ-VOTSOKGWSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | 4-[(E)-2-phenylethenyl]benzoic acid |
| InChIKey | IAGXTPCOGVFRSQ-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)