CAS 2259708-00-2 appears in our catalog under these names: Sacubitril-(2R,4R)-Isomer, Sacubitril Impurity B. Offered by: Chemat Brand. Available pack sizes: on request.
4-[[(2R,4R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoic acid (CAS 2259708-00-2) is a chemical compound with the molecular formula C24H29NO5 and a molecular weight of 411.5 g/mol. IUPAC name: 4-[[(2R,4R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoic acid. InChIKey: PYNXFZCZUAOOQC-DYESRHJHSA-N.
| Molecular formula | C24H29NO5 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | 4-[[(2R,4R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoic acid |
| InChIKey | PYNXFZCZUAOOQC-DYESRHJHSA-N |
| SMILES | CCOC(=O)[C@H](C)C[C@H](CC1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)