Products 1884269-07-1
CAS 1884269-07-1 appears in our catalog under these names: AHU377–d4, Sacubitril-d4, Sacubitril-d4, >95% (HPLC), AHU-377-d4, Sacubitril-d4, 98.54%. Offered by: GLPBio, Chemat Brand, TRC, TargetMol, Biosynth. Available pack sizes: 1mg, on request, 10mg, 25mg, 5mg, 500μg, 2mg, 1 mg.
2,2,3,3-tetradeuterio-4-[[(2S,4R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoic acid (CAS 1884269-07-1) is a chemical compound with the molecular formula C24H29NO5 and a molecular weight of 415.5 g/mol. IUPAC name: 2,2,3,3-tetradeuterio-4-[[(2S,4R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoic acid. InChIKey: PYNXFZCZUAOOQC-JCZLLWNUSA-N.
| Molecular formula | C24H29NO5 |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | 2,2,3,3-tetradeuterio-4-[[(2S,4R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoic acid |
| InChIKey | PYNXFZCZUAOOQC-JCZLLWNUSA-N |
| SMILES | [2H]C([2H])(C(=O)N[C@H](CC1=CC=C(C=C1)C2=CC=CC=C2)C[C@@H](C)C(=O)OCC)C([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Sacubitril-d4, orb2281031