cas: 885951-77-9 — see every product listed under this CAS number, including other names
Fmoc-1-amino-1-cyclobutane carboxylic acid, 98%, 98% (CAS 885951-77-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114D4A-250mg |
| cas | 885951-77-9 |
| size | 250mg |
| availability | 286.15g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 10g | 237.20 Pln | |
| Chemat | 25g | 434.00 Pln | |
| Chemat | 50g | 770.00 Pln | |
| Chemat | 100g | 1408.40 Pln | |
| Chemat | 250g | 2867.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclobutane-1-carboxylic acid (CAS 885951-77-9) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclobutane-1-carboxylic acid. InChIKey: QGLSMDZVGLRTKH-UHFFFAOYSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclobutane-1-carboxylic acid |
| InChIKey | QGLSMDZVGLRTKH-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)