CAS 885951-77-9 appears in our catalog under these names: 1–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)cyclobutane–1–carboxylic acid, Fmoc-AC4C-OH, Fmoc-Ac4c-OH 98%, Fmoc-1-amino-1-cyclobutane carboxylic acid, 98%, 98%, Fmoc-1-Amino-1-cyclobutanecarboxylic acid, 95%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg, 100g, 10g, 50g, 250g.
1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclobutane-1-carboxylic acid (CAS 885951-77-9) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclobutane-1-carboxylic acid. InChIKey: QGLSMDZVGLRTKH-UHFFFAOYSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclobutane-1-carboxylic acid |
| InChIKey | QGLSMDZVGLRTKH-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)