cas: 284492-03-1 — see every product listed under this CAS number, including other names
Fmoc-3-amino-3-(2-methylphenyl)-propionic acid, 98% (CAS 284492-03-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F300129-50MG |
| cas | 284492-03-1 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 237.43 Pln | |
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 346.77 Pln | |
| Fluorochem | 1g | 893.45 Pln | |
| Fluorochem | 5g | 3267.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-methylphenyl)propanoic acid (CAS 284492-03-1) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-methylphenyl)propanoic acid. InChIKey: WLJJHZZZEHMKOE-UHFFFAOYSA-N.
| Molecular formula | C25H23NO4 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-methylphenyl)propanoic acid |
| InChIKey | WLJJHZZZEHMKOE-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)