cas: 94744-50-0 — see every product listed under this CAS number, including other names
Fmoc-Aib-OH 98% (CAS 94744-50-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A142078-5g |
| cas | 94744-50-0 |
| size | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 203.50 Pln | |
| Ambeed | 100g | 375.94 Pln | |
| Ambeed | 500g | 1583.00 Pln | |
| Ambeed | 1000g | 3090.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A142078 |
2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid (CAS 94744-50-0) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid. InChIKey: HOZZVEPRYYCBTO-UHFFFAOYSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid |
| InChIKey | HOZZVEPRYYCBTO-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)