CAS 94744-50-0 appears in our catalog under these names: Fmoc–Aib–OH, Fmoc-Aib-OH, 2-(Fmoc-amino)isobutyric acid, 98% , Fmoc-α-methylalanine, 2-[(9H-Fluoren-9-ylmethoxy)carbonylamino]isobutyric Acid, >98.0%(HPLC)(T). Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 100g, 5g, 25g, 0,1kg, 0,25kg, 0,5kg, 2kg, 1kg.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid (CAS 94744-50-0) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid. InChIKey: HOZZVEPRYYCBTO-UHFFFAOYSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid |
| InChIKey | HOZZVEPRYYCBTO-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)