cas: 193693-65-1 — see every product listed under this CAS number, including other names
Fmoc-D-β-Pro-OH 95% (CAS 193693-65-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A628117-100mg |
| cas | 193693-65-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 364.81 Pln | |
| Ambeed | 1g | 576.19 Pln | |
| Ambeed | 5g | 1727.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A628117 |
(3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid (CAS 193693-65-1) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid. InChIKey: GUAMYYOQAAUXLR-CYBMUJFWSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid |
| InChIKey | GUAMYYOQAAUXLR-CYBMUJFWSA-N |
| SMILES | C1CN(C[C@@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)