cas: 170642-27-0 — see every product listed under this CAS number, including other names
Fmoc-D-Abu-OH 97% (CAS 170642-27-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A498821-1g |
| cas | 170642-27-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 164.56 Pln | |
| Ambeed | 100g | 442.69 Pln | |
| Ambeed | 500g | 1705.38 Pln | |
| Ambeed | 1000g | 2689.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A498821 |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 170642-27-0) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: XQIRYUNKLVPVRR-QGZVFWFLSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | XQIRYUNKLVPVRR-QGZVFWFLSA-N |
| SMILES | CC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)