cas: 170642-27-0 — see every product listed under this CAS number, including other names
Fmoc-D-Abu-OH, 97%, 97% (CAS 170642-27-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1189J3-1g |
| cas | 170642-27-0 |
| size | 1g |
| availability | 3000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 126.80 Pln | |
| Chemat | 100g | 328.40 Pln | |
| Chemat | 500g | 1406.40 Pln | |
| Chemat | 1kg | 2219.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 170642-27-0) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: XQIRYUNKLVPVRR-QGZVFWFLSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | XQIRYUNKLVPVRR-QGZVFWFLSA-N |
| SMILES | CC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)