cas: 478183-67-4 — see every product listed under this CAS number, including other names
Fmoc-D-Phe(3-I)-OH 97% (CAS 478183-67-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A212143-1g |
| cas | 478183-67-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 982.25 Pln | |
| Ambeed | 10g | 1888.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A212143 |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-iodophenyl)propanoic acid (CAS 478183-67-4) is a chemical compound with the molecular formula C24H20INO4 and a molecular weight of 513.3 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-iodophenyl)propanoic acid. InChIKey: SSKOJXLIQFVOGC-JOCHJYFZSA-N.
| Molecular formula | C24H20INO4 |
|---|---|
| Molecular weight | 513.3 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-iodophenyl)propanoic acid |
| InChIKey | SSKOJXLIQFVOGC-JOCHJYFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC(=CC=C4)I)C(=O)O |
Computed by PubChem (NCBI)