cas: 215178-45-3 — see every product listed under this CAS number, including other names
Fmoc-D-Pro-ol 95% (CAS 215178-45-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A117325-1g |
| cas | 215178-45-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1377.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A117325 |
9H-fluoren-9-ylmethyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 215178-45-3) is a chemical compound with the molecular formula C20H21NO3 and a molecular weight of 323.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: HJUXXCOVGMCKQL-CQSZACIVSA-N.
| Molecular formula | C20H21NO3 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | HJUXXCOVGMCKQL-CQSZACIVSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)CO |
Computed by PubChem (NCBI)