cas: 184763-07-3 — see every product listed under this CAS number, including other names
Fmoc-DL-Aze-OH 95% (CAS 184763-07-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A922845-100mg |
| cas | 184763-07-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 592.88 Pln | |
| Ambeed | 250mg | 932.19 Pln | |
| Ambeed | 1g | 1838.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A922845 |
1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid (CAS 184763-07-3) is a chemical compound with the molecular formula C19H17NO4 and a molecular weight of 323.3 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid. InChIKey: BXRZCDISGRVJCA-UHFFFAOYSA-N.
| Molecular formula | C19H17NO4 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid |
| InChIKey | BXRZCDISGRVJCA-UHFFFAOYSA-N |
| SMILES | C1CN(C1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)