cas: 84793-07-7 — see every product listed under this CAS number, including other names
Fmoc-Glu-OtBu, 98% (CAS 84793-07-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A175101-1g |
| cas | 84793-07-7 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 542.81 Pln | |
| Ambeed | 500g | 2411.81 Pln | |
| Ambeed | 1kg | 4753.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CAS 84793-07-7) is a chemical compound with the molecular formula C24H27NO6 and a molecular weight of 425.5 g/mol. IUPAC name: (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid. InChIKey: GOPWHXPXSPIIQZ-FQEVSTJZSA-N.
| Molecular formula | C24H27NO6 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| InChIKey | GOPWHXPXSPIIQZ-FQEVSTJZSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)