CAS 84793-07-7 appears in our catalog under these names: Fmoc–Glu–OtBu, Fmoc-L-Glu-OtBu, N-Fmoc-L-glutamic acid 1-tert-butyl ester, 98% , Fmoc-Glu-OtBu, >98.0%(HPLC)(T), Fmoc-Glu-OtBu, 98.00%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI, Chemat. Available pack sizes: 100g, 25g, 500g, 1g, 5g, 10g, 50g, 250g.
(4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CAS 84793-07-7) is a chemical compound with the molecular formula C24H27NO6 and a molecular weight of 425.5 g/mol. IUPAC name: (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid. InChIKey: GOPWHXPXSPIIQZ-FQEVSTJZSA-N.
| Molecular formula | C24H27NO6 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| InChIKey | GOPWHXPXSPIIQZ-FQEVSTJZSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)