CAS 109745-15-5 appears in our catalog under these names: (R)–4–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–5–(tert–butoxy)–5–oxopentanoic acid, Fmoc-D-Glu-OtBu, Fmoc-D-Glu-OtBu, 95%, 95%, Fmoc-D-glu-OtBu, min. 95 %, 10 g, Fmoc-D-glu-OtBu, min. 95 %, 25 g. Offered by: GLPBio, Iris Biotech, Biosynth, Chemat, Roth. Available pack sizes: 100g, 10g, 25g, 5g, 50g, 250g, 250mg, 1g.
(4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CAS 109745-15-5) is a chemical compound with the molecular formula C24H27NO6 and a molecular weight of 425.5 g/mol. IUPAC name: (4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid. InChIKey: GOPWHXPXSPIIQZ-HXUWFJFHSA-N.
| Molecular formula | C24H27NO6 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | (4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| InChIKey | GOPWHXPXSPIIQZ-HXUWFJFHSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H](CCC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)