cas: 86895-14-9 — see every product listed under this CAS number, including other names
Fmoc-Gly-Val-OH, 99.82% (CAS 86895-14-9) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 10 g, 25 g, 5 g, 50 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W013751-100 g |
| cas | 86895-14-9 |
| size | 100 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 4239.23 Pln | |
| MedChemExpress | 10 g | 928.06 Pln | |
| MedChemExpress | 25 g | 1731.47 Pln | |
| MedChemExpress | 5 g | 621.55 Pln | |
| MedChemExpress | 50 g | 2697.42 Pln | |
| MedChemExpress | 1 g | 319.69 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.82% |
(2S)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-3-methylbutanoic acid (CAS 86895-14-9) is a chemical compound with the molecular formula C22H24N2O5 and a molecular weight of 396.4 g/mol. IUPAC name: (2S)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-3-methylbutanoic acid. InChIKey: ORVHFHUXDLSLMX-FQEVSTJZSA-N.
| Molecular formula | C22H24N2O5 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | (2S)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-3-methylbutanoic acid |
| InChIKey | ORVHFHUXDLSLMX-FQEVSTJZSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)CNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)