CAS 1093072-86-6 appears in our catalog under these names: Escitalopram EP Impurity L Oxalate (Desfluoro Citalopram Oxalate), rac Desfluoro Citalopram Oxalate, >95% (HPLC), 1-(3-(Dimethylamino)propyl)-1-phenyl-1,3-dihydroisobenzofuran-5-carbonitrile oxalate, 95%, 95%. Offered by: Chemat Brand, TRC, Chemat. Available pack sizes: on request, 10mg, 25mg, 5mg.
1-[3-(dimethylamino)propyl]-1-phenyl-3H-2-benzofuran-5-carbonitrile;oxalic acid (CAS 1093072-86-6) is a chemical compound with the molecular formula C22H24N2O5 and a molecular weight of 396.4 g/mol. IUPAC name: 1-[3-(dimethylamino)propyl]-1-phenyl-3H-2-benzofuran-5-carbonitrile;oxalic acid. InChIKey: MCSDUGFBIQIOCC-UHFFFAOYSA-N.
| Molecular formula | C22H24N2O5 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | 1-[3-(dimethylamino)propyl]-1-phenyl-3H-2-benzofuran-5-carbonitrile;oxalic acid |
| InChIKey | MCSDUGFBIQIOCC-UHFFFAOYSA-N |
| SMILES | CN(C)CCCC1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=CC=C3.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)