CAS 86895-14-9 appears in our catalog under these names: Fmoc–Gly–Val–OH, Fmoc-Gly-Val-OH 98%, Fmoc-Gly-Val-OH, 99.82%, N-Fmoc-glycyl-L-valine, 98%. Offered by: GLPBio, Ambeed, MedChemExpress, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 100 g, 10 g, 25 g.
(2S)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-3-methylbutanoic acid (CAS 86895-14-9) is a chemical compound with the molecular formula C22H24N2O5 and a molecular weight of 396.4 g/mol. IUPAC name: (2S)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-3-methylbutanoic acid. InChIKey: ORVHFHUXDLSLMX-FQEVSTJZSA-N.
| Molecular formula | C22H24N2O5 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | (2S)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-3-methylbutanoic acid |
| InChIKey | ORVHFHUXDLSLMX-FQEVSTJZSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)CNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)