Products 1346617-31-9
CAS 1346617-31-9 is the registry number for (S)-Desfluoro Citalopram Oxalate. Offered by: TRC. Available pack sizes: 250mg.
(1S)-1-[3-(dimethylamino)propyl]-1-phenyl-3H-2-benzofuran-5-carbonitrile;oxalic acid (CAS 1346617-31-9) is a chemical compound with the molecular formula C22H24N2O5 and a molecular weight of 396.4 g/mol. IUPAC name: (1S)-1-[3-(dimethylamino)propyl]-1-phenyl-3H-2-benzofuran-5-carbonitrile;oxalic acid. InChIKey: MCSDUGFBIQIOCC-BDQAORGHSA-N.
| Molecular formula | C22H24N2O5 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | (1S)-1-[3-(dimethylamino)propyl]-1-phenyl-3H-2-benzofuran-5-carbonitrile;oxalic acid |
| InChIKey | MCSDUGFBIQIOCC-BDQAORGHSA-N |
| SMILES | CN(C)CCC[C@@]1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=CC=C3.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
(S)-Desfluoro Citalopram Oxalate