Products 17350-17-3
CAS 17350-17-3 appears in our catalog under these names: Z-Pro-phe-oh, 98%, (S)-2-((S)-1-((Benzyloxy)carbonyl)pyrrolidine-2-carboxamido)-3-phenylpropanoic acid, 97%, Z–Pro–Phe–OH. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 25g.
(2S)-3-phenyl-2-[[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]amino]propanoic acid (CAS 17350-17-3) is a chemical compound with the molecular formula C22H24N2O5 and a molecular weight of 396.4 g/mol. IUPAC name: (2S)-3-phenyl-2-[[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]amino]propanoic acid. InChIKey: GMUYSWQSSRROPG-OALUTQOASA-N.
| Molecular formula | C22H24N2O5 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | (2S)-3-phenyl-2-[[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]amino]propanoic acid |
| InChIKey | GMUYSWQSSRROPG-OALUTQOASA-N |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2=CC=CC=C2)C(=O)N[C@@H](CC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)