cas: 146346-88-5 — see every product listed under this CAS number, including other names
Fmoc-L-Ala-OMe 97% (CAS 146346-88-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A282728-25g |
| cas | 146346-88-5 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 209.06 Pln | |
| Ambeed | 100g | 609.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A282728 |
Methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (CAS 146346-88-5) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate. InChIKey: NLYFFHNUTFDXLO-LBPRGKRZSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| InChIKey | NLYFFHNUTFDXLO-LBPRGKRZSA-N |
| SMILES | C[C@@H](C(=O)OC)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)