cas: 71989-14-5 — see every product listed under this CAS number, including other names
Fmoc-L-Asp(OtBu)-OH, 98%, 98% (CAS 71989-14-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 50g, 100g, 250g, 500g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145XR-5g |
| cas | 71989-14-5 |
| size | 5g |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 50g | 146.00 Pln | |
| Chemat | 100g | 227.60 Pln | |
| Chemat | 250g | 467.60 Pln | |
| Chemat | 500g | 888.00 Pln | |
| Chemat | 1kg | 1629.20 Pln | |
| Chemat | 5kg | 6369.60 Pln | |
| Chemat | 10kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 71989-14-5) is a chemical compound with the molecular formula C23H25NO6 and a molecular weight of 411.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: FODJWPHPWBKDON-UHFFFAOYSA-N.
| Molecular formula | C23H25NO6 |
|---|---|
| Molecular weight | 411.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | FODJWPHPWBKDON-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)