cas: 1212257-18-5 — see every product listed under this CAS number, including other names
Fmoc-L-Cyclopropylglycine, 98%, 98% (CAS 1212257-18-5) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 250g, 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110G8F-50g |
| cas | 1212257-18-5 |
| size | 50g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 3165.20 Pln | |
| Chemat | 100g | 4888.40 Pln | |
| Chemat | 250g | 7067.60 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 500mg | 222.80 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 683.60 Pln | |
| Chemat | 10g | 1163.60 Pln | |
| Chemat | 25g | 2474.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 1212257-18-5) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (2S)-2-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: YMLZBPTXRMNAFP-SFHVURJKSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (2S)-2-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | YMLZBPTXRMNAFP-SFHVURJKSA-N |
| SMILES | C1CC1[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)