CAS 1212257-18-5 appears in our catalog under these names: (S)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–2–cyclopropylacetic acid, Fmoc-L-cPrGly-OH, Fmoc-(S)-2-Cyclopropyl-Gly-OH 95%, Fmoc-L-Cyclopropylglycine, 98%, 98%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-cyclopropylacetic acid, 98%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg, 25g, 50g, 100g.
(2S)-2-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 1212257-18-5) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (2S)-2-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: YMLZBPTXRMNAFP-SFHVURJKSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (2S)-2-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | YMLZBPTXRMNAFP-SFHVURJKSA-N |
| SMILES | C1CC1[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)