cas: 35661-39-3 — see every product listed under this CAS number, including other names
Fmoc-L-alanine, 98%, 98% (CAS 35661-39-3) is a chemical reagent available from Chemat. Available pack sizes: 250g, 10kg, 5g, 10g, 50g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I83U-250g |
| cas | 35661-39-3 |
| size | 250g |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250g | 246.80 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 50g | 102.80 Pln | |
| Chemat | 100g | 136.40 Pln | |
| Chemat | 500g | 475.20 Pln | |
| Chemat | 1kg | 822.80 Pln | |
| Chemat | 5kg | 3235.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 35661-39-3) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 311.3 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: QWXZOFZKSQXPDC-NSHDSACASA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | QWXZOFZKSQXPDC-NSHDSACASA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)