Products 202326-53-2
CAS 202326-53-2 appears in our catalog under these names: Fmoc-Ala-OH-1-13C, FMOC-ALA-OH-1-13C, 99 ATOM % 13C, Fmoc-Ala-OH-1-13C, 98%. Offered by: Creative Peptides, Sigma-Aldrich, MedChemExpress. Available pack sizes: on request, 1G, 50 mg, 100 mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)(113C)propanoic acid (CAS 202326-53-2) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 312.32 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)(113C)propanoic acid. InChIKey: QWXZOFZKSQXPDC-ADMDGPAWSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 312.32 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)(113C)propanoic acid |
| InChIKey | QWXZOFZKSQXPDC-ADMDGPAWSA-N |
| SMILES | C[C@@H]([13C](=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)