Products 225101-69-9
CAS 225101-69-9 appears in our catalog under these names: Fmoc-(D4)Ala-OH, N-Fmoc-L-alanine-d4, L-Alanine-2,3,3,3-d4-N-FMOC, 98 atom % D, min 98% Chemical Purity, Fmoc-Ala-OH-d4. Offered by: Creative Peptides, TRC, CDN, Biosynth, MedChemExpress. Available pack sizes: 0,5g, 1g, 100mg, 10mg, 0,25g, 1000mg, 500mg, 250 mg.
(2S)-2,3,3,3-tetradeuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 225101-69-9) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 315.4 g/mol. IUPAC name: (2S)-2,3,3,3-tetradeuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: QWXZOFZKSQXPDC-UAMNTACQSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | (2S)-2,3,3,3-tetradeuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | QWXZOFZKSQXPDC-UAMNTACQSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])[2H])NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)