CAS 35661-39-3 appears in our catalog under these names: N-Fmoc-L-alanine, Fmoc–Ala–OH, Fmoc-L-Ala-OH*H2O, Nalpha-Fmoc-L-alanine, 95% , Fmoc-Ala-OH, 99.00%. Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 100g, 250g, 25g, 500g, 5g, 1kg, 0,5kg, 2kg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 35661-39-3) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 311.3 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: QWXZOFZKSQXPDC-NSHDSACASA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | QWXZOFZKSQXPDC-NSHDSACASA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)