cas: 105047-45-8 — see every product listed under this CAS number, including other names
Fmoc-Lys-OH 97% (CAS 105047-45-8) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A186089-1000g |
| cas | 105047-45-8 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 9910.06 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 381.50 Pln | |
| Ambeed | 100g | 1299.31 Pln | |
| Ambeed | 500g | 6216.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A186089 |
(2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 105047-45-8) is a chemical compound with the molecular formula C21H24N2O4 and a molecular weight of 368.4 g/mol. IUPAC name: (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: YRKFMPDOFHQWPI-IBGZPJMESA-N.
| Molecular formula | C21H24N2O4 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | YRKFMPDOFHQWPI-IBGZPJMESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCN)C(=O)O |
Computed by PubChem (NCBI)